CHEM 102 Study GuideExam # 3 Study Guide Lectures: 15-19Lecture 15 (October 21st) 1. What were the five things we had to remember about chapter 7?2. Describe the synthesis of a Carboxylic Acid ( How is it made?)3. Name the following Carboxylic acids- CH3CH2CH2COOH- CH3CH2CH2(CH3)CH2CH2COOH- CH3(Br)CH2CH2CH2COOH- CH3CH2(Cl)CH2CH2(CH3CH2)COOH4. What is Formic acid? Acetic acid?5. Do carboxylic acids have strong or weak hydrogen bonding?6. List the boiling points of the families in order from greatest to least7. How is a Carboxylate ion formed?8. Complete the following reaction- CH3CH2COOH + H2O  ???9. How are Carboxylate Salts formed?10. Complete the following reaction- CH3CH2CH2COOH + NaOH  ???11. Name the Carboxylate Salt- CH3CH2CH2CH2CH2COOH Cl12. How is an Ester formed?13. Complete the following reaction- CH3CH2COOH + H-O-C  ???14. Which results in a Carboxylic Aid and an alcohol Acid or base hydrolysis? Which results ina Carboxylate salt and an alcohol?15. Name the following - CH3-CH2-CH2-C(=O)Cl16. How are Acid Anhydrides formed? How are they named?Lecture 16 (October 28th)1. What is the difference between Amines and Amides?2. How are Amines classified?3. How do you name primary Amines?4. Name the following- CH3CH2CH2CH2NH2- CH3CH2CH2CH2NH2- CH3CH2(Br)CH2CH2CH2NH25. How do you name secondary and tertiary amines?6. Name the following- CH3CH2CH2NHCH2CH2CH2CH37. Do primary and secondary amines have strong or weak hydrogen bonding? Tertiary?8. What is the result of a reaction with an primary amine and an acid?9. DO the following reaction- CH2NH2 + HCl  ???10. How do you name amine salts?11. What two things make an amine?12. Complete the following reaction- NH3 + CH3OH  ???13. Name the following- CH3CH2C(=O)NH214. How are amides created?15. Complete the Following reaction- CH3CH2CH2C(=O)OH + NH3  ???16. What does acid hydrolysis of an amide produce? Basic Hydrolysis?Lecture 17 (November 6th)1. What is the difference between a constitutional isomer and a stereoisomer?2. What is an Enantiomer? Draw an example3. What is a diastereomer? Draw an example4. What criteria do compounds have to meet to me enantiomers?5. What is the Chiral Center?6. Where is the Chiral Center in this compound?-http://upload.wikimedia.org/wikipedia/commons/3/31/D-Apiose_Fischer_projection.pngLecture 18 (November 11th)1. Carbohydrates are also known as _______.2. What are the different functions of Glucose? List everything you can about Glucose3. What are the different functions of Starch? List everything you can about Starch4. What are the different functions of Glycogen? Cellulose? List everything you can about both5. What are the 2 classes of Carbohydrates?6. What are 4 more in depth classifications of Carbohydrates?7. How do you name a stereoisomers D or L?8. Name facts about D-Glucose9. What four things do hemiacetal carbons have to have on them to be hemiacetal?10. What is a disaccharide?11. How do you tell if a disaccharide is Alpha or Beta?12. How do you determine the linkage of a disaccharide?13. Name facts about Maltose, Cellobiose, Lactose, and Sucrose.14. What is the linkage for sucrose?15. What is a reducing sugar?16. What is a polysaccharide?17. What is the difference between Amylose and