CHEM 102 1st EditionExam # 2 Study GuideLecture 8 ( September 23rd)1. Define Organic Chemistry2. The ability for an atom to bond to itself multiple times is called __________. __________ can do the above process billions of times.3. Define Hydrocarbons4. What is an Alkane?5. Saturated vs. Unsaturated6. What is the combining powers rule?7. What is the difference between the expanded molecular formula and the expanded structural formula?8. Are Alkanes…a. Tetrahedralb. Trigonal Planar9. What is an isomer?10. Draw the structural and molecular formulas for Pentane11. Name and draw the isomers for C5H1212. Name this Alkane C-C-C-C-C-CLecture 9 (September 25th)13. What is an Alkyl?14. Name the different Alkyl groups and draw them.15. Name this Alkane CH3CH2CH(CH3)CH2CH(CH3CH3)CH316. What are cycloalkanes?17. Name the five different cycloalkanes and draw them18. What are the two reactions of Alkanes and cycloalkanes, and what are their products?19. What is the product of this monohalogenation reaction? C-C-C-C-C + F  ________________20. What are the four halogens that can react in a monohalogenation reaction?21. Name all the organic products formed when I reacts with 3,4 – dimethyl – HexaneLecture 10 (September 30th)22. What are Alkenes?23. How are Alkenes formed?24. Name the AlkeneC-C=C-C-C25. Name the different isomers for C5H1026. Name this AlkeneC-C=C-C=C-C27. What are Cis and Trans isomers? Draw a Cis isomer and a Trans isomer.28. For Cyclo cis/trans isomers, you cannot compare ___ and __________. 29. What are the reactions for Alkenes?30. Describe what happens during an Addition Reaction? What are the types of Addition reactions?Lecture 11 (October 2nd)31. What is the Order of Carbon Atoms?32. What is a Major product? What is a Minor product? How do you tell if a product is majoror minor?33. What is an Alkyne? Is it Linear, Trigonal Planar, or Tetrahedral? What is the bond angle?34. What is an Aromatic Compound?35. List and draw the 6 Aromatic Compounds we need to remember on page B57Lecture 12 (October 7th)36. What an Alcohol? What is its general formula? What is the bond angle and molecular geometry?37. Name the Alcohol C5H12O38. Name the constitutional isomers for C5H12O39. How do you tell if an alcohol is secondary or primary?40. How do you name a compound with a double bond and an OH group?41. Draw this cyclo Alcohol2-methyl cyclopentanol42. What are thy physical properties of Alcohols?43. Explain hydrogen bonding in Alcohols.44. Can alcohols act as acids and bases? Under what circumstances?45. Name the reactions for alcohols. What are their products?46. Explain how dehydration works. What happens when there are temperatures of 180 andabove or 140 and below?47. Explain how Oxidation works. What happens when you oxidize a primary alcohol? Secondary?48. What is a Phenol? What is the Phenol we need to know?49. How do you name Phenols?50. What is an Ether?51. What are the two ways to name Ethers?52. Name the Ether in both ways C-O-C53. How are Ethers formed?54. Name the products of this reactionCH3CH2CH2-OH + H  _______________________Lecture 13 (October 9th)55. What is an Aldehyde? A Ketone?56. What is a carbonyl group?57. Where is the carbonyl group located on an Aldehyde? Ketone?58. Name this compoundC-C-C-CHO59. Name this compoundC-C-C(=O)-C-C60. Name the constitutional isomers for C4H8O61. What are the molecular formulas for each Family?62. What are the physical properties for Aldehydes and Ketones?63. Put these in order from highest boiling point to lowest:Hydrocarbons, alcohols, Ethers, Aldehydes and Ketones64. What are the reactions for Aldehydes and Ketones?65. Explain how Oxidation works for Aldehydes and Ketones.