Sig Fig Calculation and Nomenclature Worksheeta) Do the indicated arithmetic and give the answer to the correct number of significant figures. a) (0.871 x 0.23)/5.871 = b) 8.937 - 8.930 = c) 8.937 + 8.930 = d) (0.00015 x 54.6)/1.002 = e) (22.7858 x 2.46) + 344.75 = f) (87.7 - 24.704) / 0.0057 = g) [(2.62×106) / 51.224] + 132.78 =h) [(1.7×106 )/2.53×105 )] + 7.73 = i) (9162 +53 -9.9) x 7.7×106 = j) (3.41 m -0.23 m) / 5.233 s = k) 5.56 kg x (2.3 m / (4.223 s -.08 s)) = 2) Provide names for the following compounds and give the general category they belong to (i.e. ionic, molecular, acid, base or hydrate).Na2SO4 Al2(SO4)3 (NH4)3PO4Fe(NO3)3MnCl3NO2Ca(OH)2B2O3H2SO4 (aq) Fe(ClO4)2P2O5HCN (aq)HBr (aq) CuSO4•5H2OHg(NO2)2Br2K2HPO4MgF2CaH2 PH3NaHCO3Al(NO2)3Cu(ClO2)2CoCl2•6H2OPb(C2O4)2Cu2CrO4 (Latin)(Latin)3. Provide the formulas for the following compounds and give the general category they belong to:calcium carbonate lithium fluoridedichlorine heptoxide ammonium sulfideammonium sulfite nickel(II) carbonatecarbonic acid sulfurous aciddinitrogen tetroxide nitrogen monoxidesulfur trioxide hydrogen sulfideacetic acid lead (IV) oxidehydrofluoric acid magnesium sulfate heptahydratealuminum hydroxide chlorous acidcuperous bromide Stannic dichromateperchloric acid hydrochloric acidphosphoric acid sodium sulfidepotassium oxide ammonium nitratecobalt(III) sulfate barium acetateFerric bisulfate Mercurous
View Full Document
Unlocking...