Intensive Organic Chemistry for Freshmen Due: Feb.09.2001 Problem Set 2 1. Specify oxidation states of the metal, coordination number and geometry of the following complexes. CONiOCCOCOa) RhPh3PHHb) FeCOPPh3c)+BF4- d)ReOCBBOOOOOC NPtNHTfO-+e) 2. Draw products A and B; C and D. OBOHABrPd(PPh3)4 (cat)DMF, H2O, NaOHBOO9-BBNCIOOPd(PPh3)4 (cat)DMF, H2O, NaOHDBH9-BBN: 3. Compound 1 was prepared as shown below via organometallic chemistry. Director of a scale-up team assigned you the development of a more economical synthesis of 1. How would you solve this problem? (Hint: Suzuki reaction)BrOHEt2CuLiEt2O, -30oCOH1 4. From which of the following compounds can you prepare Grignard reagents directly? Propose a solution for those compounds you foresee a problem. Bra) OClb) OBrc) NH2Brd) HOIe) OBrf)
View Full Document