SPRING 2009 A. Nomenclature: (16 points) Give an acceptable name for each of the following compounds. Be sure to indicate the stereochemistry where appropriate. 1. 2. 3. 4. H2CCHCH2OHH CH2CH2BrOHHHOBrOHH3CH2COB. Facts: Total points = 15 1. Place the following compounds in order of increasing reactivity with CH3CH2NH2. (1=least reactive, 3=most reactive) (3 pts) 2. Place the following resonance contributors in order of increasing stability. (1=least reactive, 3=most reactive) (3 pts) 3. Place the following molecules in order of increasing reactivity in a Diels-Alder reaction. (1=least reactive, 3=most reactive) (3 pts) 4. Answer the following questions for the molecule below and place the answers in the appropriate boxes. (i) How many distinct types of protons are present in the molecule? (ii) How many distinct carbons are present? (iii), (iv) & (v) What are the theoretically predicted multiplicities (splitting patterns) of the signal for protons a, b, and c? (vi) What is the multiplicity of carbon d in the proton coupled 13C NMR? (6 pts) (i) # of proton types (ii) # of carbon types (iii) Multiplicity of Ha (iv) Multiplicity of Ha (v) Multiplicity of Ha (vi) Multiplicity of Ha OOONOCH3HNOCH3HNOCH3HOOOOCH3OCH CH2CH2OHHHHOCH2CHCH3H3CabcdC. Reactions: Total = 30 pts, 6 points each Please provide the reagents or major product in the answer box unless indicated otherwise. Indicate stereochemistry with wedges and dashes if applicable. Partial credit is awarded only when intermediate products in a multi-step reaction are shown below the reaction. 1. 2. 3. CH31. MCPBA2. CH3S-Na+3. H3O+Note: MCPBA= m-chloroperbenzoic acidOCH3CH3O1. CH3MgBr (2 eq)2. H2SO4/ Heat (2 eq)3. HBr/ peroxide (2 eq)CH3H3COOHeat4. 5. H3O+/ 0oCMajor ProductMinor ProductBrBrD. Mechanism: (13 points) Provide a clear mechanism to explain the formation of the product. Use curved arrows to indicate “electron flow.” Remember to show only one step at a time. Show all intermediates and all formal charges. Do not show transition states BrOHBrOOCH3CH3O-Na+(xs)E. Synthesis: (13 points) Synthesize the molecule below using any of the following reagents: alcohols, alkanes, alkenes, and/or alkynes of three carbons or less, any inorganic reagents, any oxidizing or reducing agents, and any peroxyacids.